C15H20N2O5 — CID 88906290
methyl (3S)-2-nitroso-3-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 88906290) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl (3S)-2-nitroso-3-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (3S)-2-nitroso-3-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 88906290 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | methyl (3S)-2-nitroso-3-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCC[C@H](NC(=O)OCc1ccccc1)C(N=O)C(=O)OC |
| InChI | InChI=1S/C15H20N2O5/c1-3-7-12(13(17-20)14(18)21-2)16-15(19)22-10-11-8-5-4-6-9-11/h4-6,8-9,12-13H,3,7,10H2,1-2H3,(H,16,19)/t12-,13?/m0/s1 |
| InChIKey | ZPECWXUQKSRPAD-UEWDXFNNSA-N |
| XLogP | 2.39 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |