C23H23NO4S — CID 14949493
benzyl N-[1-(4-methylphenyl)sulfonyl-2-phenylethyl]carbamate (PubChem CID 14949493) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is benzyl N-[1-(4-methylphenyl)sulfonyl-2-phenylethyl]carbamate.
| Compound Name | benzyl N-[1-(4-methylphenyl)sulfonyl-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 14949493 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | benzyl N-[1-(4-methylphenyl)sulfonyl-2-phenylethyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)C(Cc2ccccc2)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-18-12-14-21(15-13-18)29(26,27)22(16-19-8-4-2-5-9-19)24-23(25)28-17-20-10-6-3-7-11-20/h2-15,22H,16-17H2,1H3,(H,24,25) |
| InChIKey | NHJPMBOTUAUFKT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |