C22H29NO3 — CID 174536151
1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid (PubChem CID 174536151) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid.
| Compound Name | 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid |
|---|---|
| PubChem CID | 174536151 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid |
| SMILES | CCCCC(=O)N[C@H](C(=O)O)C(C)C.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H19NO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4-5-6-8(12)11-9(7(2)3)10(13)14/h1-10H;7,9H,4-6H2,1-3H3,(H,11,12)(H,13,14)/t;9-/m.0/s1 |
| InChIKey | GJEQNUYOZRRCQM-NPULLEENSA-N |
| XLogP | 4.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |