1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid

C22H29NO3 — CID 174536151

IUPAC1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid
SMILESCCCCC(=O)N[C@H](C(=O)O)C(C)C.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C12H10.C10H19NO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4-5-6-8(12)11-9(7(2)3)10(13)14/h1-10H;7,9H,4-6H2,1-3H3,(H,11,12)(H,13,14)/t;9-/m.0/s1
InChIKeyGJEQNUYOZRRCQM-NPULLEENSA-N
MW355.48 g/mol
LogP4.76
Rot. Bonds7

About 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid

1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid (PubChem CID 174536151) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid.

Molecular Properties

Compound Name1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid
PubChem CID174536151
Molecular FormulaC22H29NO3
Molecular Weight355.48 g/mol
Exact Mass355.21
IUPAC Name1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid
SMILESCCCCC(=O)N[C@H](C(=O)O)C(C)C.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C12H10.C10H19NO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4-5-6-8(12)11-9(7(2)3)10(13)14/h1-10H;7,9H,4-6H2,1-3H3,(H,11,12)(H,13,14)/t;9-/m.0/s1
InChIKeyGJEQNUYOZRRCQM-NPULLEENSA-N
XLogP4.76
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.48
LogP ≤ 54.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid?
The IUPAC name of 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid (CID 174536151) is 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid.
What is the SMILES notation for 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid?
The canonical SMILES for 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid is CCCCC(=O)N[C@H](C(=O)O)C(C)C.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid?
The InChIKey is GJEQNUYOZRRCQM-NPULLEENSA-N. The full InChI is InChI=1S/C12H10.C10H19NO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4-5-6-8(12)11-9(7(2)3)10(13)14/h1-10H;7,9H,4-6H2,1-3H3,(H,11,12)(H,13,14)/t;9-/m.0/s1.
What are the key properties of 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid?
1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid has a molecular weight of 355.48 g/mol, XLogP of 4.76, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;(2S)-3-methyl-2-(pentanoylamino)butanoic acid is sourced from PubChem (CID 174536151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).