C15H24N2O5 — CID 174776333
2-(hexanoylamino)-3-methylbutanoic acid;pyrrole-2,5-dione (PubChem CID 174776333) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-(hexanoylamino)-3-methylbutanoic acid;pyrrole-2,5-dione.
| Compound Name | 2-(hexanoylamino)-3-methylbutanoic acid;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 174776333 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-(hexanoylamino)-3-methylbutanoic acid;pyrrole-2,5-dione |
| SMILES | CCCCCC(=O)NC(C(=O)O)C(C)C.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C11H21NO3.C4H3NO2/c1-4-5-6-7-9(13)12-10(8(2)3)11(14)15;6-3-1-2-4(7)5-3/h8,10H,4-7H2,1-3H3,(H,12,13)(H,14,15);1-2H,(H,5,6,7) |
| InChIKey | HQPNOCDPDHTODW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|