C10H17N3O3 — CID 175186516
hexanehydrazide;pyrrole-2,5-dione (PubChem CID 175186516) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is hexanehydrazide;pyrrole-2,5-dione.
| Compound Name | hexanehydrazide;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175186516 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | hexanehydrazide;pyrrole-2,5-dione |
| SMILES | CCCCCC(=O)NN.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C6H14N2O.C4H3NO2/c1-2-3-4-5-6(9)8-7;6-3-1-2-4(7)5-3/h2-5,7H2,1H3,(H,8,9);1-2H,(H,5,6,7) |
| InChIKey | FQTFVFMOGUBIRZ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|