C31H54N2O5 — CID 173199656
8-(5-formyl-2,3-dioctoxyphenoxy)octanehydrazide (PubChem CID 173199656) has the molecular formula C31H54N2O5 and a molecular weight of 534.78 g/mol. Its IUPAC name is 8-(5-formyl-2,3-dioctoxyphenoxy)octanehydrazide.
| Compound Name | 8-(5-formyl-2,3-dioctoxyphenoxy)octanehydrazide |
|---|---|
| PubChem CID | 173199656 |
| Molecular Formula | C31H54N2O5 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.40 |
| IUPAC Name | 8-(5-formyl-2,3-dioctoxyphenoxy)octanehydrazide |
| SMILES | CCCCCCCCOc1cc(C=O)cc(OCCCCCCCC(=O)NN)c1OCCCCCCCC |
| InChI | InChI=1S/C31H54N2O5/c1-3-5-7-9-13-17-21-36-28-24-27(26-34)25-29(31(28)38-23-19-14-10-8-6-4-2)37-22-18-15-11-12-16-20-30(35)33-32/h24-26H,3-23,32H2,1-2H3,(H,33,35) |
| InChIKey | RHBCVXJLTQYYAA-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|