C21H26O5S2 — CID 102416293
(6R)-6-[bis(benzenesulfonyl)methyl]octan-4-one (PubChem CID 102416293) has the molecular formula C21H26O5S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is (6R)-6-[bis(benzenesulfonyl)methyl]octan-4-one.
| Compound Name | (6R)-6-[bis(benzenesulfonyl)methyl]octan-4-one |
|---|---|
| PubChem CID | 102416293 |
| Molecular Formula | C21H26O5S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (6R)-6-[bis(benzenesulfonyl)methyl]octan-4-one |
| SMILES | CCCC(=O)C[C@@H](CC)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H26O5S2/c1-3-11-18(22)16-17(4-2)21(27(23,24)19-12-7-5-8-13-19)28(25,26)20-14-9-6-10-15-20/h5-10,12-15,17,21H,3-4,11,16H2,1-2H3/t17-/m1/s1 |
| InChIKey | GWIYJBITGDNZNN-QGZVFWFLSA-N |
| XLogP | 4.05 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |