C21H20O5S2 — CID 101238373
(2S)-3,3-bis(benzenesulfonyl)-2-phenylpropan-1-ol (PubChem CID 101238373) has the molecular formula C21H20O5S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2S)-3,3-bis(benzenesulfonyl)-2-phenylpropan-1-ol.
| Compound Name | (2S)-3,3-bis(benzenesulfonyl)-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101238373 |
| Molecular Formula | C21H20O5S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (2S)-3,3-bis(benzenesulfonyl)-2-phenylpropan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C([C@H](CO)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O5S2/c22-16-20(17-10-4-1-5-11-17)21(27(23,24)18-12-6-2-7-13-18)28(25,26)19-14-8-3-9-15-19/h1-15,20-22H,16H2/t20-/m1/s1 |
| InChIKey | WKXLHCIKHJKXPS-HXUWFJFHSA-N |
| XLogP | 3.04 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |