C24H26O6S2 — CID 102028108
(2S,3R)-4,4-bis(benzenesulfonyl)-3-(4-methoxyphenyl)-2-methylbutan-1-ol (PubChem CID 102028108) has the molecular formula C24H26O6S2 and a molecular weight of 474.60 g/mol. Its IUPAC name is (2S,3R)-4,4-bis(benzenesulfonyl)-3-(4-methoxyphenyl)-2-methylbutan-1-ol.
| Compound Name | (2S,3R)-4,4-bis(benzenesulfonyl)-3-(4-methoxyphenyl)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 102028108 |
| Molecular Formula | C24H26O6S2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (2S,3R)-4,4-bis(benzenesulfonyl)-3-(4-methoxyphenyl)-2-methylbutan-1-ol |
| SMILES | COc1ccc([C@H](C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)[C@H](C)CO)cc1 |
| InChI | InChI=1S/C24H26O6S2/c1-18(17-25)23(19-13-15-20(30-2)16-14-19)24(31(26,27)21-9-5-3-6-10-21)32(28,29)22-11-7-4-8-12-22/h3-16,18,23-25H,17H2,1-2H3/t18-,23-/m1/s1 |
| InChIKey | KYSUOMLVMCCFOI-WZONZLPQSA-N |
| XLogP | 3.68 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |