C20H26O3 — CID 53474824
(2R,3S)-4,4-bis(4-methoxyphenyl)-2,3-dimethylbutan-1-ol (PubChem CID 53474824) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2R,3S)-4,4-bis(4-methoxyphenyl)-2,3-dimethylbutan-1-ol.
| Compound Name | (2R,3S)-4,4-bis(4-methoxyphenyl)-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 53474824 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (2R,3S)-4,4-bis(4-methoxyphenyl)-2,3-dimethylbutan-1-ol |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)[C@H](C)[C@@H](C)CO)cc1 |
| InChI | InChI=1S/C20H26O3/c1-14(13-21)15(2)20(16-5-9-18(22-3)10-6-16)17-7-11-19(23-4)12-8-17/h5-12,14-15,20-21H,13H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | KNNDRKYGLWRDFU-LSDHHAIUSA-N |
| XLogP | 4.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |