C22H21NO7S2 — CID 139257025
1-[1,1-bis(benzenesulfonyl)-3-nitropropan-2-yl]-4-methoxybenzene (PubChem CID 139257025) has the molecular formula C22H21NO7S2 and a molecular weight of 475.54 g/mol. Its IUPAC name is 1-[1,1-bis(benzenesulfonyl)-3-nitropropan-2-yl]-4-methoxybenzene.
| Compound Name | 1-[1,1-bis(benzenesulfonyl)-3-nitropropan-2-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 139257025 |
| Molecular Formula | C22H21NO7S2 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 1-[1,1-bis(benzenesulfonyl)-3-nitropropan-2-yl]-4-methoxybenzene |
| SMILES | COc1ccc(C(C[N+](=O)[O-])C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO7S2/c1-30-18-14-12-17(13-15-18)21(16-23(24)25)22(31(26,27)19-8-4-2-5-9-19)32(28,29)20-10-6-3-7-11-20/h2-15,21-22H,16H2,1H3 |
| InChIKey | OQHILAUTJKIFQH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|