C19H21NO5 — CID 102173330
methyl (3R,4S)-4-(4-methoxyphenyl)-5-nitro-3-phenylpentanoate (PubChem CID 102173330) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl (3R,4S)-4-(4-methoxyphenyl)-5-nitro-3-phenylpentanoate.
| Compound Name | methyl (3R,4S)-4-(4-methoxyphenyl)-5-nitro-3-phenylpentanoate |
|---|---|
| PubChem CID | 102173330 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl (3R,4S)-4-(4-methoxyphenyl)-5-nitro-3-phenylpentanoate |
| SMILES | COC(=O)C[C@@H](c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H21NO5/c1-24-16-10-8-15(9-11-16)18(13-20(22)23)17(12-19(21)25-2)14-6-4-3-5-7-14/h3-11,17-18H,12-13H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | MGZQEQBCZAXCGN-ZWKOTPCHSA-N |
| XLogP | 3.40 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|