C25H26N2O6S — CID 46222533
methyl (1Z,2S,3R)-3-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonyl-4-nitro-2-phenylbutanimidate (PubChem CID 46222533) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is methyl (1Z,2S,3R)-3-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonyl-4-nitro-2-phenylbutanimidate.
| Compound Name | methyl (1Z,2S,3R)-3-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonyl-4-nitro-2-phenylbutanimidate |
|---|---|
| PubChem CID | 46222533 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | methyl (1Z,2S,3R)-3-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonyl-4-nitro-2-phenylbutanimidate |
| SMILES | CO/C(=N\S(=O)(=O)c1ccc(C)cc1)[C@H](c1ccccc1)[C@@H](C[N+](=O)[O-])c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-18-9-15-22(16-10-18)34(30,31)26-25(33-3)24(20-7-5-4-6-8-20)23(17-27(28)29)19-11-13-21(32-2)14-12-19/h4-16,23-24H,17H2,1-3H3/b26-25-/t23-,24+/m0/s1 |
| InChIKey | PAGRDMGDHNDKOH-SSKHZTOISA-N |
| XLogP | 4.58 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|