C28H25NO5 — CID 53348923
(1E,6E)-4-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-1,7-diphenylhepta-1,6-diene-3,5-dione (PubChem CID 53348923) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is (1E,6E)-4-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-1,7-diphenylhepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-1,7-diphenylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 53348923 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (1E,6E)-4-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-1,7-diphenylhepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc([C@@H](C[N+](=O)[O-])C(C(=O)/C=C/c2ccccc2)C(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO5/c1-34-24-16-14-23(15-17-24)25(20-29(32)33)28(26(30)18-12-21-8-4-2-5-9-21)27(31)19-13-22-10-6-3-7-11-22/h2-19,25,28H,20H2,1H3/b18-12+,19-13+/t25-/m1/s1 |
| InChIKey | NFUXKAXBAMQANG-SMZNEUEPSA-N |
| XLogP | 5.24 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|