C28H25NO4 — CID 53349025
(1E,6E)-4-[(1S)-1-(4-methylphenyl)-2-nitroethyl]-1,7-diphenylhepta-1,6-diene-3,5-dione (PubChem CID 53349025) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is (1E,6E)-4-[(1S)-1-(4-methylphenyl)-2-nitroethyl]-1,7-diphenylhepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4-[(1S)-1-(4-methylphenyl)-2-nitroethyl]-1,7-diphenylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 53349025 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (1E,6E)-4-[(1S)-1-(4-methylphenyl)-2-nitroethyl]-1,7-diphenylhepta-1,6-diene-3,5-dione |
| SMILES | Cc1ccc([C@@H](C[N+](=O)[O-])C(C(=O)/C=C/c2ccccc2)C(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO4/c1-21-12-16-24(17-13-21)25(20-29(32)33)28(26(30)18-14-22-8-4-2-5-9-22)27(31)19-15-23-10-6-3-7-11-23/h2-19,25,28H,20H2,1H3/b18-14+,19-15+/t25-/m1/s1 |
| InChIKey | LAPNYYOLBRXRRY-NWMCAAAASA-N |
| XLogP | 5.54 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|