C23H26O2S2 — CID 102511754
(E)-2-[bis(ethylsulfanyl)methyl]-5-(4-methylphenyl)-1-phenylpent-4-ene-1,3-dione (PubChem CID 102511754) has the molecular formula C23H26O2S2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (E)-2-[bis(ethylsulfanyl)methyl]-5-(4-methylphenyl)-1-phenylpent-4-ene-1,3-dione.
| Compound Name | (E)-2-[bis(ethylsulfanyl)methyl]-5-(4-methylphenyl)-1-phenylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 102511754 |
| Molecular Formula | C23H26O2S2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (E)-2-[bis(ethylsulfanyl)methyl]-5-(4-methylphenyl)-1-phenylpent-4-ene-1,3-dione |
| SMILES | CCSC(SCC)C(C(=O)/C=C/c1ccc(C)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26O2S2/c1-4-26-23(27-5-2)21(22(25)19-9-7-6-8-10-19)20(24)16-15-18-13-11-17(3)12-14-18/h6-16,21,23H,4-5H2,1-3H3/b16-15+ |
| InChIKey | IASIWRSKCFNLJM-FOCLMDBBSA-N |
| XLogP | 5.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|