C24H18O3 — CID 175303406
(E)-2-benzoyl-1,5-diphenylpent-4-ene-1,3-dione (PubChem CID 175303406) has the molecular formula C24H18O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (E)-2-benzoyl-1,5-diphenylpent-4-ene-1,3-dione.
| Compound Name | (E)-2-benzoyl-1,5-diphenylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 175303406 |
| Molecular Formula | C24H18O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (E)-2-benzoyl-1,5-diphenylpent-4-ene-1,3-dione |
| SMILES | O=C(/C=C/c1ccccc1)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18O3/c25-21(17-16-18-10-4-1-5-11-18)22(23(26)19-12-6-2-7-13-19)24(27)20-14-8-3-9-15-20/h1-17,22H/b17-16+ |
| InChIKey | OOPOASDSCGGZGX-WUKNDPDISA-N |
| XLogP | 4.65 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|