C27H21F2NO4 — CID 177421056
(1Z,6E)-1,7-bis(2-fluorophenyl)-4-[(1R)-2-nitro-1-phenylethyl]hepta-1,6-diene-3,5-dione (PubChem CID 177421056) has the molecular formula C27H21F2NO4 and a molecular weight of 461.46 g/mol. Its IUPAC name is (1Z,6E)-1,7-bis(2-fluorophenyl)-4-[(1R)-2-nitro-1-phenylethyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1Z,6E)-1,7-bis(2-fluorophenyl)-4-[(1R)-2-nitro-1-phenylethyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 177421056 |
| Molecular Formula | C27H21F2NO4 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (1Z,6E)-1,7-bis(2-fluorophenyl)-4-[(1R)-2-nitro-1-phenylethyl]hepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C\c1ccccc1F)C(C(=O)/C=C/c1ccccc1F)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C27H21F2NO4/c28-23-12-6-4-10-20(23)14-16-25(31)27(22(18-30(33)34)19-8-2-1-3-9-19)26(32)17-15-21-11-5-7-13-24(21)29/h1-17,22,27H,18H2/b16-14-,17-15+/t22-,27?/m0/s1 |
| InChIKey | IPGDGACDGAWHHU-BRRDSBBOSA-N |
| XLogP | 5.51 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|