C10H11NO4S — CID 102475512
(2S,3S)-4-nitro-3-phenyl-2-sulfanylbutanoic acid (PubChem CID 102475512) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is (2S,3S)-4-nitro-3-phenyl-2-sulfanylbutanoic acid.
| Compound Name | (2S,3S)-4-nitro-3-phenyl-2-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 102475512 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | (2S,3S)-4-nitro-3-phenyl-2-sulfanylbutanoic acid |
| SMILES | O=C(O)[C@@H](S)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C10H11NO4S/c12-10(13)9(16)8(6-11(14)15)7-4-2-1-3-5-7/h1-5,8-9,16H,6H2,(H,12,13)/t8-,9+/m1/s1 |
| InChIKey | MBJUAZXOFAOTFH-BDAKNGLRSA-N |
| XLogP | 1.43 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|