C22H19FO4S — CID 2885001
3-(benzenesulfonyl)-1-(4-fluorophenyl)-3-(4-methoxyphenyl)propan-1-one (PubChem CID 2885001) has the molecular formula C22H19FO4S and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-(4-fluorophenyl)-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | 3-(benzenesulfonyl)-1-(4-fluorophenyl)-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 2885001 |
| Molecular Formula | C22H19FO4S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-(benzenesulfonyl)-1-(4-fluorophenyl)-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(CC(=O)c2ccc(F)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19FO4S/c1-27-19-13-9-17(10-14-19)22(28(25,26)20-5-3-2-4-6-20)15-21(24)16-7-11-18(23)12-8-16/h2-14,22H,15H2,1H3 |
| InChIKey | MYPSECYPRNTVMA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |