C28H23FO5S2 — CID 132524867
(3R)-4,4-bis(benzenesulfonyl)-3-(4-fluorophenyl)-1-phenylbutan-1-one (PubChem CID 132524867) has the molecular formula C28H23FO5S2 and a molecular weight of 522.62 g/mol. Its IUPAC name is (3R)-4,4-bis(benzenesulfonyl)-3-(4-fluorophenyl)-1-phenylbutan-1-one.
| Compound Name | (3R)-4,4-bis(benzenesulfonyl)-3-(4-fluorophenyl)-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 132524867 |
| Molecular Formula | C28H23FO5S2 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | (3R)-4,4-bis(benzenesulfonyl)-3-(4-fluorophenyl)-1-phenylbutan-1-one |
| SMILES | O=C(C[C@H](c1ccc(F)cc1)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23FO5S2/c29-23-18-16-21(17-19-23)26(20-27(30)22-10-4-1-5-11-22)28(35(31,32)24-12-6-2-7-13-24)36(33,34)25-14-8-3-9-15-25/h1-19,26,28H,20H2/t26-/m1/s1 |
| InChIKey | UFJWUDPCWYIEDO-AREMUKBSSA-N |
| XLogP | 5.46 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |