C31H28FNO4S — CID 162349367
N-[2-benzoyl-5-(4-fluorophenyl)-5-oxo-3-phenylpentyl]-4-methylbenzenesulfonamide (PubChem CID 162349367) has the molecular formula C31H28FNO4S and a molecular weight of 529.63 g/mol. Its IUPAC name is N-[2-benzoyl-5-(4-fluorophenyl)-5-oxo-3-phenylpentyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-benzoyl-5-(4-fluorophenyl)-5-oxo-3-phenylpentyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 162349367 |
| Molecular Formula | C31H28FNO4S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | N-[2-benzoyl-5-(4-fluorophenyl)-5-oxo-3-phenylpentyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C(=O)c2ccccc2)C(CC(=O)c2ccc(F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28FNO4S/c1-22-12-18-27(19-13-22)38(36,37)33-21-29(31(35)25-10-6-3-7-11-25)28(23-8-4-2-5-9-23)20-30(34)24-14-16-26(32)17-15-24/h2-19,28-29,33H,20-21H2,1H3 |
| InChIKey | MTRUEGLRULOKRQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |