C19H15FO3S2 — CID 1129019
(3S)-3-(benzenesulfonyl)-1-(4-fluorophenyl)-3-thiophen-2-ylpropan-1-one (PubChem CID 1129019) has the molecular formula C19H15FO3S2 and a molecular weight of 374.46 g/mol. Its IUPAC name is (3S)-3-(benzenesulfonyl)-1-(4-fluorophenyl)-3-thiophen-2-ylpropan-1-one.
| Compound Name | (3S)-3-(benzenesulfonyl)-1-(4-fluorophenyl)-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 1129019 |
| Molecular Formula | C19H15FO3S2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | (3S)-3-(benzenesulfonyl)-1-(4-fluorophenyl)-3-thiophen-2-ylpropan-1-one |
| SMILES | O=C(C[C@@H](c1cccs1)S(=O)(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15FO3S2/c20-15-10-8-14(9-11-15)17(21)13-19(18-7-4-12-24-18)25(22,23)16-5-2-1-3-6-16/h1-12,19H,13H2/t19-/m0/s1 |
| InChIKey | QWDFOVGGIOSCRM-IBGZPJMESA-N |
| XLogP | 4.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |