C12H14ClNO2S2 — CID 20982711
2-(benzenesulfonyl)-2-thiophen-2-ylethanamine;hydrochloride (PubChem CID 20982711) has the molecular formula C12H14ClNO2S2 and a molecular weight of 303.84 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-thiophen-2-ylethanamine;hydrochloride.
| Compound Name | 2-(benzenesulfonyl)-2-thiophen-2-ylethanamine;hydrochloride |
|---|---|
| PubChem CID | 20982711 |
| Molecular Formula | C12H14ClNO2S2 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-(benzenesulfonyl)-2-thiophen-2-ylethanamine;hydrochloride |
| SMILES | Cl.NCC(c1cccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13NO2S2.ClH/c13-9-12(11-7-4-8-16-11)17(14,15)10-5-2-1-3-6-10;/h1-8,12H,9,13H2;1H |
| InChIKey | AFMWZGYIIYPTEF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |