C14H17NO4S3 — CID 7280102
N-[(2S)-2-(benzenesulfonyl)-2-thiophen-2-ylethyl]ethanesulfonamide (PubChem CID 7280102) has the molecular formula C14H17NO4S3 and a molecular weight of 359.49 g/mol. Its IUPAC name is N-[(2S)-2-(benzenesulfonyl)-2-thiophen-2-ylethyl]ethanesulfonamide.
| Compound Name | N-[(2S)-2-(benzenesulfonyl)-2-thiophen-2-ylethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 7280102 |
| Molecular Formula | C14H17NO4S3 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-[(2S)-2-(benzenesulfonyl)-2-thiophen-2-ylethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@@H](c1cccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO4S3/c1-2-21(16,17)15-11-14(13-9-6-10-20-13)22(18,19)12-7-4-3-5-8-12/h3-10,14-15H,2,11H2,1H3/t14-/m0/s1 |
| InChIKey | OZPYYADQIFWDCY-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |