C18H23NO3S2 — CID 22583984
N-[2-(benzenesulfonyl)-2-thiophen-2-ylethyl]-3,3-dimethylbutanamide (PubChem CID 22583984) has the molecular formula C18H23NO3S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)-2-thiophen-2-ylethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(benzenesulfonyl)-2-thiophen-2-ylethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 22583984 |
| Molecular Formula | C18H23NO3S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[2-(benzenesulfonyl)-2-thiophen-2-ylethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCC(c1cccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO3S2/c1-18(2,3)12-17(20)19-13-16(15-10-7-11-23-15)24(21,22)14-8-5-4-6-9-14/h4-11,16H,12-13H2,1-3H3,(H,19,20) |
| InChIKey | DRAYEPLNVPUWPM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |