C23H19NO4S2 — CID 139256356
4,4-bis(benzenesulfonyl)-2-methylidene-3-phenylbutanenitrile (PubChem CID 139256356) has the molecular formula C23H19NO4S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4,4-bis(benzenesulfonyl)-2-methylidene-3-phenylbutanenitrile.
| Compound Name | 4,4-bis(benzenesulfonyl)-2-methylidene-3-phenylbutanenitrile |
|---|---|
| PubChem CID | 139256356 |
| Molecular Formula | C23H19NO4S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 4,4-bis(benzenesulfonyl)-2-methylidene-3-phenylbutanenitrile |
| SMILES | C=C(C#N)C(c1ccccc1)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19NO4S2/c1-18(17-24)22(19-11-5-2-6-12-19)23(29(25,26)20-13-7-3-8-14-20)30(27,28)21-15-9-4-10-16-21/h2-16,22-23H,1H2 |
| InChIKey | DBQXMLLZGSGADP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|