C27H26O7S2 — CID 56653945
methyl (3R)-4,4-bis(benzenesulfonyl)-2-methylidene-3-(2-prop-2-enoxyphenyl)butanoate (PubChem CID 56653945) has the molecular formula C27H26O7S2 and a molecular weight of 526.63 g/mol. Its IUPAC name is methyl (3R)-4,4-bis(benzenesulfonyl)-2-methylidene-3-(2-prop-2-enoxyphenyl)butanoate.
| Compound Name | methyl (3R)-4,4-bis(benzenesulfonyl)-2-methylidene-3-(2-prop-2-enoxyphenyl)butanoate |
|---|---|
| PubChem CID | 56653945 |
| Molecular Formula | C27H26O7S2 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | methyl (3R)-4,4-bis(benzenesulfonyl)-2-methylidene-3-(2-prop-2-enoxyphenyl)butanoate |
| SMILES | C=CCOc1ccccc1[C@H](C(=C)C(=O)OC)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26O7S2/c1-4-19-34-24-18-12-11-17-23(24)25(20(2)26(28)33-3)27(35(29,30)21-13-7-5-8-14-21)36(31,32)22-15-9-6-10-16-22/h4-18,25,27H,1-2,19H2,3H3/t25-/m0/s1 |
| InChIKey | PZFTUJRQUCELTQ-VWLOTQADSA-N |
| XLogP | 4.34 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|