C16H20O2 — CID 102215116
4,4-dimethyl-1-(2-prop-2-enoxyphenyl)pent-2-yn-1-ol (PubChem CID 102215116) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2-prop-2-enoxyphenyl)pent-2-yn-1-ol.
| Compound Name | 4,4-dimethyl-1-(2-prop-2-enoxyphenyl)pent-2-yn-1-ol |
|---|---|
| PubChem CID | 102215116 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 4,4-dimethyl-1-(2-prop-2-enoxyphenyl)pent-2-yn-1-ol |
| SMILES | C=CCOc1ccccc1C(O)C#CC(C)(C)C |
| InChI | InChI=1S/C16H20O2/c1-5-12-18-15-9-7-6-8-13(15)14(17)10-11-16(2,3)4/h5-9,14,17H,1,12H2,2-4H3 |
| InChIKey | CFEKYVDGIBDWSX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|