C12H16O4 — CID 170819149
1-(2-prop-2-enoxyphenyl)propane-1,2,3-triol (PubChem CID 170819149) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(2-prop-2-enoxyphenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-prop-2-enoxyphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819149 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2-prop-2-enoxyphenyl)propane-1,2,3-triol |
| SMILES | C=CCOc1ccccc1C(O)C(O)CO |
| InChI | InChI=1S/C12H16O4/c1-2-7-16-11-6-4-3-5-9(11)12(15)10(14)8-13/h2-6,10,12-15H,1,7-8H2 |
| InChIKey | FHUUGJVDDPERGN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|