C19H16N2O3 — CID 135016360
(2R,3S)-2-benzamido-4-cyano-3-phenylpent-4-enoic acid (PubChem CID 135016360) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is (2R,3S)-2-benzamido-4-cyano-3-phenylpent-4-enoic acid.
| Compound Name | (2R,3S)-2-benzamido-4-cyano-3-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 135016360 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2R,3S)-2-benzamido-4-cyano-3-phenylpent-4-enoic acid |
| SMILES | C=C(C#N)[C@H](c1ccccc1)[C@@H](NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H16N2O3/c1-13(12-20)16(14-8-4-2-5-9-14)17(19(23)24)21-18(22)15-10-6-3-7-11-15/h2-11,16-17H,1H2,(H,21,22)(H,23,24)/t16-,17-/m1/s1 |
| InChIKey | DSWMNQPGXCVOQQ-IAGOWNOFSA-N |
| XLogP | 2.73 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|