C16H12N2O3 — CID 30112923
(2S)-2-[(4-cyanobenzoyl)amino]-2-phenylacetic acid (PubChem CID 30112923) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S)-2-[(4-cyanobenzoyl)amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(4-cyanobenzoyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 30112923 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (2S)-2-[(4-cyanobenzoyl)amino]-2-phenylacetic acid |
| SMILES | N#Cc1ccc(C(=O)N[C@H](C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12N2O3/c17-10-11-6-8-13(9-7-11)15(19)18-14(16(20)21)12-4-2-1-3-5-12/h1-9,14H,(H,18,19)(H,20,21)/t14-/m0/s1 |
| InChIKey | KFAZEBCBPBPZAC-AWEZNQCLSA-N |
| XLogP | 2.11 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |