C23H20N4O2 — CID 121264724
N-[2-[[amino(phenyl)methyl]amino]-2-oxo-1-phenylethyl]-4-cyanobenzamide (PubChem CID 121264724) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[2-[[amino(phenyl)methyl]amino]-2-oxo-1-phenylethyl]-4-cyanobenzamide.
| Compound Name | N-[2-[[amino(phenyl)methyl]amino]-2-oxo-1-phenylethyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 121264724 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[2-[[amino(phenyl)methyl]amino]-2-oxo-1-phenylethyl]-4-cyanobenzamide |
| SMILES | N#Cc1ccc(C(=O)NC(C(=O)NC(N)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N4O2/c24-15-16-11-13-19(14-12-16)22(28)26-20(17-7-3-1-4-8-17)23(29)27-21(25)18-9-5-2-6-10-18/h1-14,20-21H,25H2,(H,26,28)(H,27,29) |
| InChIKey | AZUXXIIGIHLPBE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|