About 2-(benzenesulfonyl)propanedinitrile;propanedinitrile
2-(benzenesulfonyl)propanedinitrile;propanedinitrile (PubChem CID 91131130) has the molecular formula C12H8N4O2S
and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-(benzenesulfonyl)propanedinitrile;propanedinitrile.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)propanedinitrile;propanedinitrile |
| PubChem CID | 91131130 |
| Molecular Formula | C12H8N4O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-(benzenesulfonyl)propanedinitrile;propanedinitrile |
| SMILES | N#CC(C#N)S(=O)(=O)c1ccccc1.N#CCC#N |
| InChI | InChI=1S/C9H6N2O2S.C3H2N2/c10-6-9(7-11)14(12,13)8-4-2-1-3-5-8;4-2-1-3-5/h1-5,9H;1H2 |
| InChIKey | JKFGCTMSDLHGIT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 129.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(benzenesulfonyl)propanedinitrile;propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)propanedinitrile;propanedinitrile?
The IUPAC name of 2-(benzenesulfonyl)propanedinitrile;propanedinitrile (CID 91131130) is 2-(benzenesulfonyl)propanedinitrile;propanedinitrile.
What is the SMILES notation for 2-(benzenesulfonyl)propanedinitrile;propanedinitrile?
The canonical SMILES for 2-(benzenesulfonyl)propanedinitrile;propanedinitrile is N#CC(C#N)S(=O)(=O)c1ccccc1.N#CCC#N.
What is the InChIKey of 2-(benzenesulfonyl)propanedinitrile;propanedinitrile?
The InChIKey is JKFGCTMSDLHGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2S.C3H2N2/c10-6-9(7-11)14(12,13)8-4-2-1-3-5-8;4-2-1-3-5/h1-5,9H;1H2.
What are the key properties of 2-(benzenesulfonyl)propanedinitrile;propanedinitrile?
2-(benzenesulfonyl)propanedinitrile;propanedinitrile has a molecular weight of 272.29 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)propanedinitrile;propanedinitrile is sourced from PubChem (CID 91131130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).