C9H10Br2O2S — CID 11035244
1,3-dibromopropan-2-ylsulfonylbenzene (PubChem CID 11035244) has the molecular formula C9H10Br2O2S and a molecular weight of 342.05 g/mol. Its IUPAC name is 1,3-dibromopropan-2-ylsulfonylbenzene.
| Compound Name | 1,3-dibromopropan-2-ylsulfonylbenzene |
|---|---|
| PubChem CID | 11035244 |
| Molecular Formula | C9H10Br2O2S |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | 1,3-dibromopropan-2-ylsulfonylbenzene |
| SMILES | O=S(=O)(c1ccccc1)C(CBr)CBr |
| InChI | InChI=1S/C9H10Br2O2S/c10-6-9(7-11)14(12,13)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | QCHLDXYWIZILLO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|