C17H28O2S — CID 102144824
2,2,6,6-tetramethylheptan-4-ylsulfonylbenzene (PubChem CID 102144824) has the molecular formula C17H28O2S and a molecular weight of 296.48 g/mol. Its IUPAC name is 2,2,6,6-tetramethylheptan-4-ylsulfonylbenzene.
| Compound Name | 2,2,6,6-tetramethylheptan-4-ylsulfonylbenzene |
|---|---|
| PubChem CID | 102144824 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2,2,6,6-tetramethylheptan-4-ylsulfonylbenzene |
| SMILES | CC(C)(C)CC(CC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H28O2S/c1-16(2,3)12-15(13-17(4,5)6)20(18,19)14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3 |
| InChIKey | XUIOCFUFPXNHAI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |