C23H21FO5S2 — CID 102104460
(2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal (PubChem CID 102104460) has the molecular formula C23H21FO5S2 and a molecular weight of 460.55 g/mol. Its IUPAC name is (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal.
| Compound Name | (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal |
|---|---|
| PubChem CID | 102104460 |
| Molecular Formula | C23H21FO5S2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal |
| SMILES | C[C@](C=O)(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FO5S2/c1-23(17-25,18-12-14-19(24)15-13-18)16-22(30(26,27)20-8-4-2-5-9-20)31(28,29)21-10-6-3-7-11-21/h2-15,17,22H,16H2,1H3/t23-/m1/s1 |
| InChIKey | JWHFDLLQZRVXHZ-HSZRJFAPSA-N |
| XLogP | 3.95 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|