About (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal
(2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal (PubChem CID 102104460) has the molecular formula C23H21FO5S2
and a molecular weight of 460.55 g/mol. Its IUPAC name is (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal.
Molecular Properties
| Compound Name | (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal |
| PubChem CID | 102104460 |
| Molecular Formula | C23H21FO5S2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal |
| SMILES | C[C@](C=O)(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FO5S2/c1-23(17-25,18-12-14-19(24)15-13-18)16-22(30(26,27)20-8-4-2-5-9-20)31(28,29)21-10-6-3-7-11-21/h2-15,17,22H,16H2,1H3/t23-/m1/s1 |
| InChIKey | JWHFDLLQZRVXHZ-HSZRJFAPSA-N |
| XLogP | 3.95 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal?
The IUPAC name of (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal (CID 102104460) is (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal.
What is the SMILES notation for (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal?
The canonical SMILES for (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal is C[C@](C=O)(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccc(F)cc1.
What is the InChIKey of (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal?
The InChIKey is JWHFDLLQZRVXHZ-HSZRJFAPSA-N. The full InChI is InChI=1S/C23H21FO5S2/c1-23(17-25,18-12-14-19(24)15-13-18)16-22(30(26,27)20-8-4-2-5-9-20)31(28,29)21-10-6-3-7-11-21/h2-15,17,22H,16H2,1H3/t23-/m1/s1.
What are the key properties of (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal?
(2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal has a molecular weight of 460.55 g/mol, XLogP of 3.95, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4-bis(benzenesulfonyl)-2-(4-fluorophenyl)-2-methylbutanal is sourced from PubChem (CID 102104460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).