C27H28ClNO7S2 — CID 102266029
tert-butyl N-[(2S)-4,4-bis(benzenesulfonyl)-2-(4-chlorophenyl)-1-oxobutan-2-yl]carbamate (PubChem CID 102266029) has the molecular formula C27H28ClNO7S2 and a molecular weight of 578.11 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4,4-bis(benzenesulfonyl)-2-(4-chlorophenyl)-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4,4-bis(benzenesulfonyl)-2-(4-chlorophenyl)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 102266029 |
| Molecular Formula | C27H28ClNO7S2 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | tert-butyl N-[(2S)-4,4-bis(benzenesulfonyl)-2-(4-chlorophenyl)-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@](C=O)(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H28ClNO7S2/c1-26(2,3)36-25(31)29-27(19-30,20-14-16-21(28)17-15-20)18-24(37(32,33)22-10-6-4-7-11-22)38(34,35)23-12-8-5-9-13-23/h4-17,19,24H,18H2,1-3H3,(H,29,31)/t27-/m1/s1 |
| InChIKey | AKNBNKUEBDHWLU-HHHXNRCGSA-N |
| XLogP | 4.92 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|