C23H23F6NO4 — CID 58718555
tert-butyl N-[(2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-2-phenylpropan-2-yl]carbamate (PubChem CID 58718555) has the molecular formula C23H23F6NO4 and a molecular weight of 491.43 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-2-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-2-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 58718555 |
| Molecular Formula | C23H23F6NO4 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-oxo-2-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@](C=O)(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C23H23F6NO4/c1-20(2,3)34-19(32)30-21(13-31,16-7-5-4-6-8-16)14-33-12-15-9-17(22(24,25)26)11-18(10-15)23(27,28)29/h4-11,13H,12,14H2,1-3H3,(H,30,32)/t21-/m1/s1 |
| InChIKey | CLLLDYDPMSWMOE-OAQYLSRUSA-N |
| XLogP | 5.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|