C19H19F3O2 — CID 89058329
(3R)-3-methyl-3-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxy]butanal (PubChem CID 89058329) has the molecular formula C19H19F3O2 and a molecular weight of 336.35 g/mol. Its IUPAC name is (3R)-3-methyl-3-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxy]butanal.
| Compound Name | (3R)-3-methyl-3-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxy]butanal |
|---|---|
| PubChem CID | 89058329 |
| Molecular Formula | C19H19F3O2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (3R)-3-methyl-3-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxy]butanal |
| SMILES | C[C@](CC=O)(COCc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H19F3O2/c1-18(10-11-23,16-7-3-2-4-8-16)14-24-13-15-6-5-9-17(12-15)19(20,21)22/h2-9,11-12H,10,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | XURAAIJYTMFYFU-SFHVURJKSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|