C16H26O4S2 — CID 2830964
(1-butylsulfonyl-3,3-dimethylbutyl)sulfonylbenzene (PubChem CID 2830964) has the molecular formula C16H26O4S2 and a molecular weight of 346.51 g/mol. Its IUPAC name is (1-butylsulfonyl-3,3-dimethylbutyl)sulfonylbenzene.
| Compound Name | (1-butylsulfonyl-3,3-dimethylbutyl)sulfonylbenzene |
|---|---|
| PubChem CID | 2830964 |
| Molecular Formula | C16H26O4S2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (1-butylsulfonyl-3,3-dimethylbutyl)sulfonylbenzene |
| SMILES | CCCCS(=O)(=O)C(CC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H26O4S2/c1-5-6-12-21(17,18)15(13-16(2,3)4)22(19,20)14-10-8-7-9-11-14/h7-11,15H,5-6,12-13H2,1-4H3 |
| InChIKey | MXLSZCWTXRMYEZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |