C19H24O5S2 — CID 45142420
(2R)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol (PubChem CID 45142420) has the molecular formula C19H24O5S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is (2R)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol.
| Compound Name | (2R)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol |
|---|---|
| PubChem CID | 45142420 |
| Molecular Formula | C19H24O5S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (2R)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol |
| SMILES | CCC[C@@H](CO)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24O5S2/c1-2-9-16(15-20)14-19(25(21,22)17-10-5-3-6-11-17)26(23,24)18-12-7-4-8-13-18/h3-8,10-13,16,19-20H,2,9,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | AFUIQFCFFZSYBS-MRXNPFEDSA-N |
| XLogP | 3.06 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |