C25H34O5S2 — CID 44556421
(Z,2R)-2-[2,2-bis(benzenesulfonyl)ethyl]undec-8-en-1-ol (PubChem CID 44556421) has the molecular formula C25H34O5S2 and a molecular weight of 478.68 g/mol. Its IUPAC name is (Z,2R)-2-[2,2-bis(benzenesulfonyl)ethyl]undec-8-en-1-ol.
| Compound Name | (Z,2R)-2-[2,2-bis(benzenesulfonyl)ethyl]undec-8-en-1-ol |
|---|---|
| PubChem CID | 44556421 |
| Molecular Formula | C25H34O5S2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (Z,2R)-2-[2,2-bis(benzenesulfonyl)ethyl]undec-8-en-1-ol |
| SMILES | CC/C=C\CCCCC[C@@H](CO)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34O5S2/c1-2-3-4-5-6-7-10-15-22(21-26)20-25(31(27,28)23-16-11-8-12-17-23)32(29,30)24-18-13-9-14-19-24/h3-4,8-9,11-14,16-19,22,25-26H,2,5-7,10,15,20-21H2,1H3/b4-3-/t22-/m1/s1 |
| InChIKey | FROIYRLLWQVLKZ-LJBSOROUSA-N |
| XLogP | 5.18 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|