C15H20O — CID 135041742
(Z,2S)-2-phenylnon-6-enal (PubChem CID 135041742) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (Z,2S)-2-phenylnon-6-enal.
| Compound Name | (Z,2S)-2-phenylnon-6-enal |
|---|---|
| PubChem CID | 135041742 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (Z,2S)-2-phenylnon-6-enal |
| SMILES | CC/C=C\CCC[C@H](C=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O/c1-2-3-4-5-7-12-15(13-16)14-10-8-6-9-11-14/h3-4,6,8-11,13,15H,2,5,7,12H2,1H3/b4-3-/t15-/m1/s1 |
| InChIKey | MFXFJLGOXALMNB-ABCZVMIZSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|