C24H34O2 — CID 141172455
(9Z,12Z,15Z)-2-phenyloctadeca-9,12,15-trienoic acid (PubChem CID 141172455) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (9Z,12Z,15Z)-2-phenyloctadeca-9,12,15-trienoic acid.
| Compound Name | (9Z,12Z,15Z)-2-phenyloctadeca-9,12,15-trienoic acid |
|---|---|
| PubChem CID | 141172455 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (9Z,12Z,15Z)-2-phenyloctadeca-9,12,15-trienoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-23(24(25)26)22-19-16-15-17-20-22/h3-4,6-7,9-10,15-17,19-20,23H,2,5,8,11-14,18,21H2,1H3,(H,25,26)/b4-3-,7-6-,10-9- |
| InChIKey | CNSGGIGJJMKGNM-PDBXOOCHSA-N |
| XLogP | 7.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|