C22H38O2 — CID 91105284
2-(2-methylpropyl)octadeca-9,12,15-trienoic acid (PubChem CID 91105284) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 2-(2-methylpropyl)octadeca-9,12,15-trienoic acid.
| Compound Name | 2-(2-methylpropyl)octadeca-9,12,15-trienoic acid |
|---|---|
| PubChem CID | 91105284 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 2-(2-methylpropyl)octadeca-9,12,15-trienoic acid |
| SMILES | CCC=CCC=CCC=CCCCCCCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C22H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(22(23)24)19-20(2)3/h5-6,8-9,11-12,20-21H,4,7,10,13-19H2,1-3H3,(H,23,24) |
| InChIKey | WSYMFSVNAGKOAP-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|