C36H58O4 — CID 87316349
(5Z,8Z,11Z)-2-hexadeca-7,10,13-trienylicosa-5,8,11-trienedioic acid (PubChem CID 87316349) has the molecular formula C36H58O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is (5Z,8Z,11Z)-2-hexadeca-7,10,13-trienylicosa-5,8,11-trienedioic acid.
| Compound Name | (5Z,8Z,11Z)-2-hexadeca-7,10,13-trienylicosa-5,8,11-trienedioic acid |
|---|---|
| PubChem CID | 87316349 |
| Molecular Formula | C36H58O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | (5Z,8Z,11Z)-2-hexadeca-7,10,13-trienylicosa-5,8,11-trienedioic acid |
| SMILES | CCC=CCC=CCC=CCCCCCCC(CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C36H58O4/c1-2-3-4-5-6-7-8-9-13-16-19-22-25-28-31-34(36(39)40)32-29-26-23-20-17-14-11-10-12-15-18-21-24-27-30-33-35(37)38/h3-4,6-7,9-10,12-14,17,23,26,34H,2,5,8,11,15-16,18-22,24-25,27-33H2,1H3,(H,37,38)(H,39,40)/b4-3?,7-6?,12-10-,13-9?,17-14-,26-23- |
| InChIKey | JMSDDRKUOPCRKE-QOGJPHPUSA-N |
| XLogP | 10.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|