C26H46O2 — CID 87559668
(9Z,12Z,15Z)-2-(2-ethylhexyl)octadeca-9,12,15-trienoic acid (PubChem CID 87559668) has the molecular formula C26H46O2 and a molecular weight of 390.65 g/mol. Its IUPAC name is (9Z,12Z,15Z)-2-(2-ethylhexyl)octadeca-9,12,15-trienoic acid.
| Compound Name | (9Z,12Z,15Z)-2-(2-ethylhexyl)octadeca-9,12,15-trienoic acid |
|---|---|
| PubChem CID | 87559668 |
| Molecular Formula | C26H46O2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | (9Z,12Z,15Z)-2-(2-ethylhexyl)octadeca-9,12,15-trienoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(CC(CC)CCCC)C(=O)O |
| InChI | InChI=1S/C26H46O2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-22-25(26(27)28)23-24(6-3)21-8-5-2/h7,9,11-12,14-15,24-25H,4-6,8,10,13,16-23H2,1-3H3,(H,27,28)/b9-7-,12-11-,15-14- |
| InChIKey | NHEASEVZAHEGBG-SKYJOKMQSA-N |
| XLogP | 8.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|