About 2-butyl-4-ethyloctanoic acid;nickel
2-butyl-4-ethyloctanoic acid;nickel (PubChem CID 87483186) has the molecular formula C14H28NiO2
and a molecular weight of 287.07 g/mol. Its IUPAC name is 2-butyl-4-ethyloctanoic acid;nickel.
Molecular Properties
| Compound Name | 2-butyl-4-ethyloctanoic acid;nickel |
| PubChem CID | 87483186 |
| Molecular Formula | C14H28NiO2 |
| Molecular Weight | 287.07 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-butyl-4-ethyloctanoic acid;nickel |
| SMILES | CCCCC(CC)CC(CCCC)C(=O)O.[Ni] |
| InChI | InChI=1S/C14H28O2.Ni/c1-4-7-9-12(6-3)11-13(14(15)16)10-8-5-2;/h12-13H,4-11H2,1-3H3,(H,15,16); |
| InChIKey | BMALTLBWPHEIMG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.07 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-4-ethyloctanoic acid;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-ethyloctanoic acid;nickel?
The IUPAC name of 2-butyl-4-ethyloctanoic acid;nickel (CID 87483186) is 2-butyl-4-ethyloctanoic acid;nickel.
What is the SMILES notation for 2-butyl-4-ethyloctanoic acid;nickel?
The canonical SMILES for 2-butyl-4-ethyloctanoic acid;nickel is CCCCC(CC)CC(CCCC)C(=O)O.[Ni].
What is the InChIKey of 2-butyl-4-ethyloctanoic acid;nickel?
The InChIKey is BMALTLBWPHEIMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.Ni/c1-4-7-9-12(6-3)11-13(14(15)16)10-8-5-2;/h12-13H,4-11H2,1-3H3,(H,15,16);.
What are the key properties of 2-butyl-4-ethyloctanoic acid;nickel?
2-butyl-4-ethyloctanoic acid;nickel has a molecular weight of 287.07 g/mol, XLogP of 4.48, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-ethyloctanoic acid;nickel is sourced from PubChem (CID 87483186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).