4-ethyl-2-hexyloctanoic acid

C16H32O2 — CID 23205425

IUPAC4-ethyl-2-hexyloctanoic acid
SMILESCCCCCCC(CC(CC)CCCC)C(=O)O
InChIInChI=1S/C16H32O2/c1-4-7-9-10-12-15(16(17)18)13-14(6-3)11-8-5-2/h14-15H,4-13H2,1-3H3,(H,17,18)
InChIKeyNWLIVYJTECLEQP-UHFFFAOYSA-N
MW256.43 g/mol
LogP5.26
Rot. Bonds12

About 4-ethyl-2-hexyloctanoic acid

4-ethyl-2-hexyloctanoic acid (PubChem CID 23205425) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 4-ethyl-2-hexyloctanoic acid.

Molecular Properties

Compound Name4-ethyl-2-hexyloctanoic acid
PubChem CID23205425
Molecular FormulaC16H32O2
Molecular Weight256.43 g/mol
Exact Mass256.24
IUPAC Name4-ethyl-2-hexyloctanoic acid
SMILESCCCCCCC(CC(CC)CCCC)C(=O)O
InChIInChI=1S/C16H32O2/c1-4-7-9-10-12-15(16(17)18)13-14(6-3)11-8-5-2/h14-15H,4-13H2,1-3H3,(H,17,18)
InChIKeyNWLIVYJTECLEQP-UHFFFAOYSA-N
XLogP5.26
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds12
Heavy Atoms18
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500256.43
LogP ≤ 55.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-ethyl-2-hexyloctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-2-hexyloctanoic acid?
The IUPAC name of 4-ethyl-2-hexyloctanoic acid (CID 23205425) is 4-ethyl-2-hexyloctanoic acid.
What is the SMILES notation for 4-ethyl-2-hexyloctanoic acid?
The canonical SMILES for 4-ethyl-2-hexyloctanoic acid is CCCCCCC(CC(CC)CCCC)C(=O)O.
What is the InChIKey of 4-ethyl-2-hexyloctanoic acid?
The InChIKey is NWLIVYJTECLEQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-4-7-9-10-12-15(16(17)18)13-14(6-3)11-8-5-2/h14-15H,4-13H2,1-3H3,(H,17,18).
What are the key properties of 4-ethyl-2-hexyloctanoic acid?
4-ethyl-2-hexyloctanoic acid has a molecular weight of 256.43 g/mol, XLogP of 5.26, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-hexyloctanoic acid is sourced from PubChem (CID 23205425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).