About 4-ethyl-2-hexyloctanoic acid
4-ethyl-2-hexyloctanoic acid (PubChem CID 23205425) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is 4-ethyl-2-hexyloctanoic acid.
Molecular Properties
| Compound Name | 4-ethyl-2-hexyloctanoic acid |
| PubChem CID | 23205425 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 4-ethyl-2-hexyloctanoic acid |
| SMILES | CCCCCCC(CC(CC)CCCC)C(=O)O |
| InChI | InChI=1S/C16H32O2/c1-4-7-9-10-12-15(16(17)18)13-14(6-3)11-8-5-2/h14-15H,4-13H2,1-3H3,(H,17,18) |
| InChIKey | NWLIVYJTECLEQP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-hexyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-hexyloctanoic acid?
The IUPAC name of 4-ethyl-2-hexyloctanoic acid (CID 23205425) is 4-ethyl-2-hexyloctanoic acid.
What is the SMILES notation for 4-ethyl-2-hexyloctanoic acid?
The canonical SMILES for 4-ethyl-2-hexyloctanoic acid is CCCCCCC(CC(CC)CCCC)C(=O)O.
What is the InChIKey of 4-ethyl-2-hexyloctanoic acid?
The InChIKey is NWLIVYJTECLEQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-4-7-9-10-12-15(16(17)18)13-14(6-3)11-8-5-2/h14-15H,4-13H2,1-3H3,(H,17,18).
What are the key properties of 4-ethyl-2-hexyloctanoic acid?
4-ethyl-2-hexyloctanoic acid has a molecular weight of 256.43 g/mol, XLogP of 5.26, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-hexyloctanoic acid is sourced from PubChem (CID 23205425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).